C8H9BrO3 — CID 130649535
(1R)-1-(2-bromo-5-hydroxyphenyl)ethane-1,2-diol (PubChem CID 130649535) has the molecular formula C8H9BrO3 and a molecular weight of 233.06 g/mol. Its IUPAC name is (1R)-1-(2-bromo-5-hydroxyphenyl)ethane-1,2-diol.
| Compound Name | (1R)-1-(2-bromo-5-hydroxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 130649535 |
| Molecular Formula | C8H9BrO3 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | (1R)-1-(2-bromo-5-hydroxyphenyl)ethane-1,2-diol |
| SMILES | OC[C@H](O)c1cc(O)ccc1Br |
| InChI | InChI=1S/C8H9BrO3/c9-7-2-1-5(11)3-6(7)8(12)4-10/h1-3,8,10-12H,4H2/t8-/m0/s1 |
| InChIKey | JESNZYCVEWXSCU-QMMMGPOBSA-N |
| XLogP | 1.18 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |