C16H25BrO — CID 114981334
1-(3-bromo-2-methylphenyl)-3-ethylheptan-1-ol (PubChem CID 114981334) has the molecular formula C16H25BrO and a molecular weight of 313.28 g/mol. Its IUPAC name is 1-(3-bromo-2-methylphenyl)-3-ethylheptan-1-ol.
| Compound Name | 1-(3-bromo-2-methylphenyl)-3-ethylheptan-1-ol |
|---|---|
| PubChem CID | 114981334 |
| Molecular Formula | C16H25BrO |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-(3-bromo-2-methylphenyl)-3-ethylheptan-1-ol |
| SMILES | CCCCC(CC)CC(O)c1cccc(Br)c1C |
| InChI | InChI=1S/C16H25BrO/c1-4-6-8-13(5-2)11-16(18)14-9-7-10-15(17)12(14)3/h7,9-10,13,16,18H,4-6,8,11H2,1-3H3 |
| InChIKey | VTYSRLBOBSZPGX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |