C16H26OS — CID 114981298
3-ethyl-1-(2-methylsulfanylphenyl)heptan-1-ol (PubChem CID 114981298) has the molecular formula C16H26OS and a molecular weight of 266.45 g/mol. Its IUPAC name is 3-ethyl-1-(2-methylsulfanylphenyl)heptan-1-ol.
| Compound Name | 3-ethyl-1-(2-methylsulfanylphenyl)heptan-1-ol |
|---|---|
| PubChem CID | 114981298 |
| Molecular Formula | C16H26OS |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 3-ethyl-1-(2-methylsulfanylphenyl)heptan-1-ol |
| SMILES | CCCCC(CC)CC(O)c1ccccc1SC |
| InChI | InChI=1S/C16H26OS/c1-4-6-9-13(5-2)12-15(17)14-10-7-8-11-16(14)18-3/h7-8,10-11,13,15,17H,4-6,9,12H2,1-3H3 |
| InChIKey | DQTHXAVVIPJLRD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |