C16H23F3OS — CID 63894731
3-ethyl-1-[4-(trifluoromethylsulfanyl)phenyl]heptan-1-ol (PubChem CID 63894731) has the molecular formula C16H23F3OS and a molecular weight of 320.42 g/mol. Its IUPAC name is 3-ethyl-1-[4-(trifluoromethylsulfanyl)phenyl]heptan-1-ol.
| Compound Name | 3-ethyl-1-[4-(trifluoromethylsulfanyl)phenyl]heptan-1-ol |
|---|---|
| PubChem CID | 63894731 |
| Molecular Formula | C16H23F3OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-ethyl-1-[4-(trifluoromethylsulfanyl)phenyl]heptan-1-ol |
| SMILES | CCCCC(CC)CC(O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H23F3OS/c1-3-5-6-12(4-2)11-15(20)13-7-9-14(10-8-13)21-16(17,18)19/h7-10,12,15,20H,3-6,11H2,1-2H3 |
| InChIKey | LNDSADFGRCNBHJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |