C13H17F3O2S — CID 67794201
1-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol (PubChem CID 67794201) has the molecular formula C13H17F3O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 1-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol.
| Compound Name | 1-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol |
|---|---|
| PubChem CID | 67794201 |
| Molecular Formula | C13H17F3O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol |
| SMILES | CCC(O)CC(O)Cc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3O2S/c1-2-10(17)8-11(18)7-9-3-5-12(6-4-9)19-13(14,15)16/h3-6,10-11,17-18H,2,7-8H2,1H3 |
| InChIKey | BCMUZKRLCBWXRF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |