C10H12F3NS — CID 171226809
(1S)-1-[4-(trifluoromethylsulfanyl)phenyl]propan-1-amine (PubChem CID 171226809) has the molecular formula C10H12F3NS and a molecular weight of 235.27 g/mol. Its IUPAC name is (1S)-1-[4-(trifluoromethylsulfanyl)phenyl]propan-1-amine.
| Compound Name | (1S)-1-[4-(trifluoromethylsulfanyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 171226809 |
| Molecular Formula | C10H12F3NS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | (1S)-1-[4-(trifluoromethylsulfanyl)phenyl]propan-1-amine |
| SMILES | CC[C@H](N)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H12F3NS/c1-2-9(14)7-3-5-8(6-4-7)15-10(11,12)13/h3-6,9H,2,14H2,1H3/t9-/m0/s1 |
| InChIKey | UMLJNOFTMYAUQV-VIFPVBQESA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |