C13H18F3NS — CID 171207274
(1R)-4-methyl-1-[4-(trifluoromethylsulfanyl)phenyl]pentan-1-amine (PubChem CID 171207274) has the molecular formula C13H18F3NS and a molecular weight of 277.36 g/mol. Its IUPAC name is (1R)-4-methyl-1-[4-(trifluoromethylsulfanyl)phenyl]pentan-1-amine.
| Compound Name | (1R)-4-methyl-1-[4-(trifluoromethylsulfanyl)phenyl]pentan-1-amine |
|---|---|
| PubChem CID | 171207274 |
| Molecular Formula | C13H18F3NS |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (1R)-4-methyl-1-[4-(trifluoromethylsulfanyl)phenyl]pentan-1-amine |
| SMILES | CC(C)CC[C@@H](N)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NS/c1-9(2)3-8-12(17)10-4-6-11(7-5-10)18-13(14,15)16/h4-7,9,12H,3,8,17H2,1-2H3/t12-/m1/s1 |
| InChIKey | DTUMDUZFPGEVCN-GFCCVEGCSA-N |
| XLogP | 4.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |