C11H12F3NS — CID 171226815
(1S)-1-[4-(trifluoromethylsulfanyl)phenyl]but-3-en-1-amine (PubChem CID 171226815) has the molecular formula C11H12F3NS and a molecular weight of 247.28 g/mol. Its IUPAC name is (1S)-1-[4-(trifluoromethylsulfanyl)phenyl]but-3-en-1-amine.
| Compound Name | (1S)-1-[4-(trifluoromethylsulfanyl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 171226815 |
| Molecular Formula | C11H12F3NS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (1S)-1-[4-(trifluoromethylsulfanyl)phenyl]but-3-en-1-amine |
| SMILES | C=CC[C@H](N)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NS/c1-2-3-10(15)8-4-6-9(7-5-8)16-11(12,13)14/h2,4-7,10H,1,3,15H2/t10-/m0/s1 |
| InChIKey | AKLNMCMWHVEXJE-JTQLQIEISA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|