C13H18F3NS — CID 171226819
(1S)-1-[4-(trifluoromethylsulfanyl)phenyl]hexan-1-amine (PubChem CID 171226819) has the molecular formula C13H18F3NS and a molecular weight of 277.36 g/mol. Its IUPAC name is (1S)-1-[4-(trifluoromethylsulfanyl)phenyl]hexan-1-amine.
| Compound Name | (1S)-1-[4-(trifluoromethylsulfanyl)phenyl]hexan-1-amine |
|---|---|
| PubChem CID | 171226819 |
| Molecular Formula | C13H18F3NS |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (1S)-1-[4-(trifluoromethylsulfanyl)phenyl]hexan-1-amine |
| SMILES | CCCCC[C@H](N)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NS/c1-2-3-4-5-12(17)10-6-8-11(9-7-10)18-13(14,15)16/h6-9,12H,2-5,17H2,1H3/t12-/m0/s1 |
| InChIKey | BKPBYAGHMRHSIT-LBPRGKRZSA-N |
| XLogP | 4.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|