C13H19ClF3NS — CID 171207247
(1R)-1-[4-(trifluoromethylsulfanyl)phenyl]hexan-1-amine;hydrochloride (PubChem CID 171207247) has the molecular formula C13H19ClF3NS and a molecular weight of 313.82 g/mol. Its IUPAC name is (1R)-1-[4-(trifluoromethylsulfanyl)phenyl]hexan-1-amine;hydrochloride.
| Compound Name | (1R)-1-[4-(trifluoromethylsulfanyl)phenyl]hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171207247 |
| Molecular Formula | C13H19ClF3NS |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (1R)-1-[4-(trifluoromethylsulfanyl)phenyl]hexan-1-amine;hydrochloride |
| SMILES | CCCCC[C@@H](N)c1ccc(SC(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C13H18F3NS.ClH/c1-2-3-4-5-12(17)10-6-8-11(9-7-10)18-13(14,15)16;/h6-9,12H,2-5,17H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | URRORFDJZTYPRY-UTONKHPSSA-N |
| XLogP | 5.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|