C11H10F3O2S- — CID 154413095
2-[4-(trifluoromethylsulfanyl)phenyl]butanoate (PubChem CID 154413095) has the molecular formula C11H10F3O2S- and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-[4-(trifluoromethylsulfanyl)phenyl]butanoate.
| Compound Name | 2-[4-(trifluoromethylsulfanyl)phenyl]butanoate |
|---|---|
| PubChem CID | 154413095 |
| Molecular Formula | C11H10F3O2S- |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-[4-(trifluoromethylsulfanyl)phenyl]butanoate |
| SMILES | CCC(C(=O)[O-])c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3O2S/c1-2-9(10(15)16)7-3-5-8(6-4-7)17-11(12,13)14/h3-6,9H,2H2,1H3,(H,15,16)/p-1 |
| InChIKey | PTBIVRMXTMPHBJ-UHFFFAOYSA-M |
| XLogP | 2.54 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |