C14H19NaO2 — CID 121491967
sodium (2S)-2-[4-(2-methylpropyl)phenyl]butanoate (PubChem CID 121491967) has the molecular formula C14H19NaO2 and a molecular weight of 242.29 g/mol. Its IUPAC name is sodium (2S)-2-[4-(2-methylpropyl)phenyl]butanoate.
| Compound Name | sodium (2S)-2-[4-(2-methylpropyl)phenyl]butanoate |
|---|---|
| PubChem CID | 121491967 |
| Molecular Formula | C14H19NaO2 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | sodium (2S)-2-[4-(2-methylpropyl)phenyl]butanoate |
| SMILES | CC[C@H](C(=O)[O-])c1ccc(CC(C)C)cc1.[Na+] |
| InChI | InChI=1S/C14H20O2.Na/c1-4-13(14(15)16)12-7-5-11(6-8-12)9-10(2)3;/h5-8,10,13H,4,9H2,1-3H3,(H,15,16);/q;+1/p-1/t13-;/m0./s1 |
| InChIKey | SJBWJHOBCVAGGD-ZOWNYOTGSA-M |
| XLogP | -0.87 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |