C13H16F3NO2S — CID 60796385
methyl 2-(propylamino)-2-[4-(trifluoromethylsulfanyl)phenyl]acetate (PubChem CID 60796385) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is methyl 2-(propylamino)-2-[4-(trifluoromethylsulfanyl)phenyl]acetate.
| Compound Name | methyl 2-(propylamino)-2-[4-(trifluoromethylsulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 60796385 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | methyl 2-(propylamino)-2-[4-(trifluoromethylsulfanyl)phenyl]acetate |
| SMILES | CCCNC(C(=O)OC)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3NO2S/c1-3-8-17-11(12(18)19-2)9-4-6-10(7-5-9)20-13(14,15)16/h4-7,11,17H,3,8H2,1-2H3 |
| InChIKey | LVEUVOGRCRVSHW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |