C19H16F3NO3S — CID 75927189
methyl 2-phenyl-2-[3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoylamino]acetate (PubChem CID 75927189) has the molecular formula C19H16F3NO3S and a molecular weight of 395.40 g/mol. Its IUPAC name is methyl 2-phenyl-2-[3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoylamino]acetate.
| Compound Name | methyl 2-phenyl-2-[3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoylamino]acetate |
|---|---|
| PubChem CID | 75927189 |
| Molecular Formula | C19H16F3NO3S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | methyl 2-phenyl-2-[3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoylamino]acetate |
| SMILES | COC(=O)C(NC(=O)C=Cc1ccc(SC(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H16F3NO3S/c1-26-18(25)17(14-5-3-2-4-6-14)23-16(24)12-9-13-7-10-15(11-8-13)27-19(20,21)22/h2-12,17H,1H3,(H,23,24) |
| InChIKey | HOWXKJAONGAIGZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|