C13H13F3O3S — CID 43102372
ethyl 2-[hydroxy-[4-(trifluoromethylsulfanyl)phenyl]methyl]prop-2-enoate (PubChem CID 43102372) has the molecular formula C13H13F3O3S and a molecular weight of 306.31 g/mol. Its IUPAC name is ethyl 2-[hydroxy-[4-(trifluoromethylsulfanyl)phenyl]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[hydroxy-[4-(trifluoromethylsulfanyl)phenyl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 43102372 |
| Molecular Formula | C13H13F3O3S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | ethyl 2-[hydroxy-[4-(trifluoromethylsulfanyl)phenyl]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)C(O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F3O3S/c1-3-19-12(18)8(2)11(17)9-4-6-10(7-5-9)20-13(14,15)16/h4-7,11,17H,2-3H2,1H3 |
| InChIKey | VRTYQQFBSCLUSO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|