C12H12Cl2O3 — CID 118722954
ethyl 2-[(3,5-dichlorophenyl)-hydroxymethyl]prop-2-enoate (PubChem CID 118722954) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is ethyl 2-[(3,5-dichlorophenyl)-hydroxymethyl]prop-2-enoate.
| Compound Name | ethyl 2-[(3,5-dichlorophenyl)-hydroxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 118722954 |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | ethyl 2-[(3,5-dichlorophenyl)-hydroxymethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)C(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2O3/c1-3-17-12(16)7(2)11(15)8-4-9(13)6-10(14)5-8/h4-6,11,15H,2-3H2,1H3 |
| InChIKey | JVMHQCJQNQSRAC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|