C32H38Cl2O10 — CID 158150253
acetyl acetate;ethyl 2-[acetyloxy-(3-chloro-4-methylphenyl)methyl]prop-2-enoate;ethyl 2-[(3-chloro-4-methylphenyl)-hydroxymethyl]prop-2-enoate (PubChem CID 158150253) has the molecular formula C32H38Cl2O10 and a molecular weight of 653.55 g/mol. Its IUPAC name is acetyl acetate;ethyl 2-[acetyloxy-(3-chloro-4-methylphenyl)methyl]prop-2-enoate;ethyl 2-[(3-chloro-4-methylphenyl)-hydroxymethyl]prop-2-enoate.
| Compound Name | acetyl acetate;ethyl 2-[acetyloxy-(3-chloro-4-methylphenyl)methyl]prop-2-enoate;ethyl 2-[(3-chloro-4-methylphenyl)-hydroxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 158150253 |
| Molecular Formula | C32H38Cl2O10 |
| Molecular Weight | 653.55 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | acetyl acetate;ethyl 2-[acetyloxy-(3-chloro-4-methylphenyl)methyl]prop-2-enoate;ethyl 2-[(3-chloro-4-methylphenyl)-hydroxymethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)C(O)c1ccc(C)c(Cl)c1.C=C(C(=O)OCC)C(OC(C)=O)c1ccc(C)c(Cl)c1.CC(=O)OC(C)=O |
| InChI | InChI=1S/C15H17ClO4.C13H15ClO3.C4H6O3/c1-5-19-15(18)10(3)14(20-11(4)17)12-7-6-9(2)13(16)8-12;1-4-17-13(16)9(3)12(15)10-6-5-8(2)11(14)7-10;1-3(5)7-4(2)6/h6-8,14H,3,5H2,1-2,4H3;5-7,12,15H,3-4H2,1-2H3;1-2H3 |
| InChIKey | FVACEJGJWXRPKS-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|