C10H13ClF3NOS — CID 170892191
2-amino-3-[4-(trifluoromethylsulfanyl)phenyl]propan-1-ol;hydrochloride (PubChem CID 170892191) has the molecular formula C10H13ClF3NOS and a molecular weight of 287.73 g/mol. Its IUPAC name is 2-amino-3-[4-(trifluoromethylsulfanyl)phenyl]propan-1-ol;hydrochloride.
| Compound Name | 2-amino-3-[4-(trifluoromethylsulfanyl)phenyl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 170892191 |
| Molecular Formula | C10H13ClF3NOS |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-amino-3-[4-(trifluoromethylsulfanyl)phenyl]propan-1-ol;hydrochloride |
| SMILES | Cl.NC(CO)Cc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H12F3NOS.ClH/c11-10(12,13)16-9-3-1-7(2-4-9)5-8(14)6-15;/h1-4,8,15H,5-6,14H2;1H |
| InChIKey | PARVDCUWSMSVHE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |