C16H22BrF3O — CID 151626696
1-bromo-3-(10,10,10-trifluorodecoxy)benzene (PubChem CID 151626696) has the molecular formula C16H22BrF3O and a molecular weight of 367.25 g/mol. Its IUPAC name is 1-bromo-3-(10,10,10-trifluorodecoxy)benzene.
| Compound Name | 1-bromo-3-(10,10,10-trifluorodecoxy)benzene |
|---|---|
| PubChem CID | 151626696 |
| Molecular Formula | C16H22BrF3O |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 1-bromo-3-(10,10,10-trifluorodecoxy)benzene |
| SMILES | FC(F)(F)CCCCCCCCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C16H22BrF3O/c17-14-9-8-10-15(13-14)21-12-7-5-3-1-2-4-6-11-16(18,19)20/h8-10,13H,1-7,11-12H2 |
| InChIKey | QPQNKFSYZWWFRS-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|