C11H9BrF6O2 — CID 102722643
1-bromo-3-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethoxy]benzene (PubChem CID 102722643) has the molecular formula C11H9BrF6O2 and a molecular weight of 367.08 g/mol. Its IUPAC name is 1-bromo-3-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethoxy]benzene.
| Compound Name | 1-bromo-3-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethoxy]benzene |
|---|---|
| PubChem CID | 102722643 |
| Molecular Formula | C11H9BrF6O2 |
| Molecular Weight | 367.08 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 1-bromo-3-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethoxy]benzene |
| SMILES | FC(F)(F)C(OCCOc1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C11H9BrF6O2/c12-7-2-1-3-8(6-7)19-4-5-20-9(10(13,14)15)11(16,17)18/h1-3,6,9H,4-5H2 |
| InChIKey | UDJXLFPFUMIDAB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.08 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|