C10H7Cl3F2O4 — CID 154287423
chloro 2-[3-(2,2-dichloro-1,1-difluoroethoxy)phenoxy]acetate (PubChem CID 154287423) has the molecular formula C10H7Cl3F2O4 and a molecular weight of 335.52 g/mol. Its IUPAC name is chloro 2-[3-(2,2-dichloro-1,1-difluoroethoxy)phenoxy]acetate.
| Compound Name | chloro 2-[3-(2,2-dichloro-1,1-difluoroethoxy)phenoxy]acetate |
|---|---|
| PubChem CID | 154287423 |
| Molecular Formula | C10H7Cl3F2O4 |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | chloro 2-[3-(2,2-dichloro-1,1-difluoroethoxy)phenoxy]acetate |
| SMILES | O=C(COc1cccc(OC(F)(F)C(Cl)Cl)c1)OCl |
| InChI | InChI=1S/C10H7Cl3F2O4/c11-9(12)10(14,15)18-7-3-1-2-6(4-7)17-5-8(16)19-13/h1-4,9H,5H2 |
| InChIKey | CMIFOZPSOBLETH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|