C24H15F3N2O6 — CID 139934179
2-nitro-4-[2,2,2-trifluoro-1-(4-hydroxy-3-nitrophenyl)-1-naphthalen-2-ylethyl]phenol (PubChem CID 139934179) has the molecular formula C24H15F3N2O6 and a molecular weight of 484.39 g/mol. Its IUPAC name is 2-nitro-4-[2,2,2-trifluoro-1-(4-hydroxy-3-nitrophenyl)-1-naphthalen-2-ylethyl]phenol.
| Compound Name | 2-nitro-4-[2,2,2-trifluoro-1-(4-hydroxy-3-nitrophenyl)-1-naphthalen-2-ylethyl]phenol |
|---|---|
| PubChem CID | 139934179 |
| Molecular Formula | C24H15F3N2O6 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 2-nitro-4-[2,2,2-trifluoro-1-(4-hydroxy-3-nitrophenyl)-1-naphthalen-2-ylethyl]phenol |
| SMILES | O=[N+]([O-])c1cc(C(c2ccc(O)c([N+](=O)[O-])c2)(c2ccc3ccccc3c2)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C24H15F3N2O6/c25-24(26,27)23(17-7-9-21(30)19(12-17)28(32)33,18-8-10-22(31)20(13-18)29(34)35)16-6-5-14-3-1-2-4-15(14)11-16/h1-13,30-31H |
| InChIKey | KSRCOOPBGWHYNE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|