C24H21F3N2O6 — CID 141179078
4-[1-(3-tert-butylphenyl)-2,2,2-trifluoro-1-(4-hydroxy-3-nitrophenyl)ethyl]-2-nitrophenol (PubChem CID 141179078) has the molecular formula C24H21F3N2O6 and a molecular weight of 490.43 g/mol. Its IUPAC name is 4-[1-(3-tert-butylphenyl)-2,2,2-trifluoro-1-(4-hydroxy-3-nitrophenyl)ethyl]-2-nitrophenol.
| Compound Name | 4-[1-(3-tert-butylphenyl)-2,2,2-trifluoro-1-(4-hydroxy-3-nitrophenyl)ethyl]-2-nitrophenol |
|---|---|
| PubChem CID | 141179078 |
| Molecular Formula | C24H21F3N2O6 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 4-[1-(3-tert-butylphenyl)-2,2,2-trifluoro-1-(4-hydroxy-3-nitrophenyl)ethyl]-2-nitrophenol |
| SMILES | CC(C)(C)c1cccc(C(c2ccc(O)c([N+](=O)[O-])c2)(c2ccc(O)c([N+](=O)[O-])c2)C(F)(F)F)c1 |
| InChI | InChI=1S/C24H21F3N2O6/c1-22(2,3)14-5-4-6-15(11-14)23(24(25,26)27,16-7-9-20(30)18(12-16)28(32)33)17-8-10-21(31)19(13-17)29(34)35/h4-13,30-31H,1-3H3 |
| InChIKey | YFTHICIRKSPAOZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|