C13H10N6 — CID 168542260
2-[[2-methyl-5-(1,2,4-triazol-4-yl)anilino]methylidene]propanedinitrile (PubChem CID 168542260) has the molecular formula C13H10N6 and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-[[2-methyl-5-(1,2,4-triazol-4-yl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[2-methyl-5-(1,2,4-triazol-4-yl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168542260 |
| Molecular Formula | C13H10N6 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-[[2-methyl-5-(1,2,4-triazol-4-yl)anilino]methylidene]propanedinitrile |
| SMILES | Cc1ccc(-n2cnnc2)cc1NC=C(C#N)C#N |
| InChI | InChI=1S/C13H10N6/c1-10-2-3-12(19-8-17-18-9-19)4-13(10)16-7-11(5-14)6-15/h2-4,7-9,16H,1H3 |
| InChIKey | OABAHEFUXYOHRL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 90.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|