C12H9N7O — CID 169340237
2-[[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169340237) has the molecular formula C12H9N7O and a molecular weight of 267.25 g/mol. Its IUPAC name is 2-[[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340237 |
| Molecular Formula | C12H9N7O |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-[[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | COc1ccc(-n2cnnc2)cc1NN=C(C#N)C#N |
| InChI | InChI=1S/C12H9N7O/c1-20-12-3-2-10(19-7-15-16-8-19)4-11(12)18-17-9(5-13)6-14/h2-4,7-8,18H,1H3 |
| InChIKey | FHJJTAGMPJJLKZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|