C11H8N6O2 — CID 169340787
2-[(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)hydrazinylidene]propanedinitrile (PubChem CID 169340787) has the molecular formula C11H8N6O2 and a molecular weight of 256.23 g/mol. Its IUPAC name is 2-[(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340787 |
| Molecular Formula | C11H8N6O2 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-[(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)hydrazinylidene]propanedinitrile |
| SMILES | COc1cc2[nH]c(=O)[nH]c2cc1NN=C(C#N)C#N |
| InChI | InChI=1S/C11H8N6O2/c1-19-10-3-8-7(14-11(18)15-8)2-9(10)17-16-6(4-12)5-13/h2-3,17H,1H3,(H2,14,15,18) |
| InChIKey | LAYBOADKDPCOOZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|