C10H6N6O2 — CID 169338596
2-[(4-methoxy-2,1,3-benzoxadiazol-7-yl)hydrazinylidene]propanedinitrile (PubChem CID 169338596) has the molecular formula C10H6N6O2 and a molecular weight of 242.20 g/mol. Its IUPAC name is 2-[(4-methoxy-2,1,3-benzoxadiazol-7-yl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(4-methoxy-2,1,3-benzoxadiazol-7-yl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169338596 |
| Molecular Formula | C10H6N6O2 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-[(4-methoxy-2,1,3-benzoxadiazol-7-yl)hydrazinylidene]propanedinitrile |
| SMILES | COc1ccc(NN=C(C#N)C#N)c2nonc12 |
| InChI | InChI=1S/C10H6N6O2/c1-17-8-3-2-7(9-10(8)16-18-15-9)14-13-6(4-11)5-12/h2-3,14H,1H3 |
| InChIKey | DGEFODVKGNBWFY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|