C12H12N4O2 — CID 169338095
2-[(4,5-dimethoxy-2-methylphenyl)hydrazinylidene]propanedinitrile (PubChem CID 169338095) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-[(4,5-dimethoxy-2-methylphenyl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(4,5-dimethoxy-2-methylphenyl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169338095 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-[(4,5-dimethoxy-2-methylphenyl)hydrazinylidene]propanedinitrile |
| SMILES | COc1cc(C)c(NN=C(C#N)C#N)cc1OC |
| InChI | InChI=1S/C12H12N4O2/c1-8-4-11(17-2)12(18-3)5-10(8)16-15-9(6-13)7-14/h4-5,16H,1-3H3 |
| InChIKey | GCNRSAUBPAYHRJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|