C10H9Cl2NO4S — CID 107049593
3,6-dichloro-2-(prop-2-enylsulfonylamino)benzoic acid (PubChem CID 107049593) has the molecular formula C10H9Cl2NO4S and a molecular weight of 310.16 g/mol. Its IUPAC name is 3,6-dichloro-2-(prop-2-enylsulfonylamino)benzoic acid.
| Compound Name | 3,6-dichloro-2-(prop-2-enylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 107049593 |
| Molecular Formula | C10H9Cl2NO4S |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | 3,6-dichloro-2-(prop-2-enylsulfonylamino)benzoic acid |
| SMILES | C=CCS(=O)(=O)Nc1c(Cl)ccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C10H9Cl2NO4S/c1-2-5-18(16,17)13-9-7(12)4-3-6(11)8(9)10(14)15/h2-4,13H,1,5H2,(H,14,15) |
| InChIKey | ONXPBQHZTXLKJL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|