C9H7Cl2F3N2O4S — CID 107049514
3,6-dichloro-2-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid (PubChem CID 107049514) has the molecular formula C9H7Cl2F3N2O4S and a molecular weight of 367.13 g/mol. Its IUPAC name is 3,6-dichloro-2-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid.
| Compound Name | 3,6-dichloro-2-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid |
|---|---|
| PubChem CID | 107049514 |
| Molecular Formula | C9H7Cl2F3N2O4S |
| Molecular Weight | 367.13 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 3,6-dichloro-2-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid |
| SMILES | O=C(O)c1c(Cl)ccc(Cl)c1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H7Cl2F3N2O4S/c10-4-1-2-5(11)7(6(4)8(17)18)16-21(19,20)15-3-9(12,13)14/h1-2,15-16H,3H2,(H,17,18) |
| InChIKey | HEFIUIZFUQRGRZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |