C10H14F3N3O2S — CID 114804848
2,6-dimethyl-1-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,4-diamine (PubChem CID 114804848) has the molecular formula C10H14F3N3O2S and a molecular weight of 297.30 g/mol. Its IUPAC name is 2,6-dimethyl-1-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,4-diamine.
| Compound Name | 2,6-dimethyl-1-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 114804848 |
| Molecular Formula | C10H14F3N3O2S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2,6-dimethyl-1-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,4-diamine |
| SMILES | Cc1cc(N)cc(C)c1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O2S/c1-6-3-8(14)4-7(2)9(6)16-19(17,18)15-5-10(11,12)13/h3-4,15-16H,5,14H2,1-2H3 |
| InChIKey | GVAXJOAWSGEPGI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|