C10H12BrF3N2O2S — CID 107575153
4-bromo-3,5-dimethyl-N-(2,2,2-trifluoroethylsulfamoyl)aniline (PubChem CID 107575153) has the molecular formula C10H12BrF3N2O2S and a molecular weight of 361.18 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-N-(2,2,2-trifluoroethylsulfamoyl)aniline.
| Compound Name | 4-bromo-3,5-dimethyl-N-(2,2,2-trifluoroethylsulfamoyl)aniline |
|---|---|
| PubChem CID | 107575153 |
| Molecular Formula | C10H12BrF3N2O2S |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 4-bromo-3,5-dimethyl-N-(2,2,2-trifluoroethylsulfamoyl)aniline |
| SMILES | Cc1cc(NS(=O)(=O)NCC(F)(F)F)cc(C)c1Br |
| InChI | InChI=1S/C10H12BrF3N2O2S/c1-6-3-8(4-7(2)9(6)11)16-19(17,18)15-5-10(12,13)14/h3-4,15-16H,5H2,1-2H3 |
| InChIKey | CZLCUTUSUPGVAR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |