C8H10F3N3O2S — CID 114804202
2-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,2-diamine (PubChem CID 114804202) has the molecular formula C8H10F3N3O2S and a molecular weight of 269.25 g/mol. Its IUPAC name is 2-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,2-diamine.
| Compound Name | 2-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 114804202 |
| Molecular Formula | C8H10F3N3O2S |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,2-diamine |
| SMILES | Nc1ccccc1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O2S/c9-8(10,11)5-13-17(15,16)14-7-4-2-1-3-6(7)12/h1-4,13-14H,5,12H2 |
| InChIKey | OBRHGHRDIHNSPY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|