C9H10ClF3N4O3S — CID 114812357
4-chloro-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)benzenecarboximidamide (PubChem CID 114812357) has the molecular formula C9H10ClF3N4O3S and a molecular weight of 346.72 g/mol. Its IUPAC name is 4-chloro-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)benzenecarboximidamide.
| Compound Name | 4-chloro-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 114812357 |
| Molecular Formula | C9H10ClF3N4O3S |
| Molecular Weight | 346.72 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 4-chloro-N'-hydroxy-2-(2,2,2-trifluoroethylsulfamoylamino)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(Cl)cc1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H10ClF3N4O3S/c10-5-1-2-6(8(14)16-18)7(3-5)17-21(19,20)15-4-9(11,12)13/h1-3,15,17-18H,4H2,(H2,14,16) |
| InChIKey | NJKHVEMVKGJYGV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|