C8H9ClF3N3O2S — CID 114270033
2-chloro-3-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,3-diamine (PubChem CID 114270033) has the molecular formula C8H9ClF3N3O2S and a molecular weight of 303.69 g/mol. Its IUPAC name is 2-chloro-3-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,3-diamine.
| Compound Name | 2-chloro-3-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 114270033 |
| Molecular Formula | C8H9ClF3N3O2S |
| Molecular Weight | 303.69 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-chloro-3-N-(2,2,2-trifluoroethylsulfamoyl)benzene-1,3-diamine |
| SMILES | Nc1cccc(NS(=O)(=O)NCC(F)(F)F)c1Cl |
| InChI | InChI=1S/C8H9ClF3N3O2S/c9-7-5(13)2-1-3-6(7)15-18(16,17)14-4-8(10,11)12/h1-3,14-15H,4,13H2 |
| InChIKey | RLQDIHDNMWVJBJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|