C9H12F3N3O2S — CID 114804619
4-[(2,2,2-trifluoroethylsulfamoylamino)methyl]aniline (PubChem CID 114804619) has the molecular formula C9H12F3N3O2S and a molecular weight of 283.28 g/mol. Its IUPAC name is 4-[(2,2,2-trifluoroethylsulfamoylamino)methyl]aniline.
| Compound Name | 4-[(2,2,2-trifluoroethylsulfamoylamino)methyl]aniline |
|---|---|
| PubChem CID | 114804619 |
| Molecular Formula | C9H12F3N3O2S |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-[(2,2,2-trifluoroethylsulfamoylamino)methyl]aniline |
| SMILES | Nc1ccc(CNS(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H12F3N3O2S/c10-9(11,12)6-15-18(16,17)14-5-7-1-3-8(13)4-2-7/h1-4,14-15H,5-6,13H2 |
| InChIKey | JKAPESLOUGQTCK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|