C12H13F3N2O3S — CID 114811778
3-[4-[(2,2,2-trifluoroethylsulfamoylamino)methyl]phenyl]prop-2-yn-1-ol (PubChem CID 114811778) has the molecular formula C12H13F3N2O3S and a molecular weight of 322.31 g/mol. Its IUPAC name is 3-[4-[(2,2,2-trifluoroethylsulfamoylamino)methyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-[(2,2,2-trifluoroethylsulfamoylamino)methyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 114811778 |
| Molecular Formula | C12H13F3N2O3S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-[4-[(2,2,2-trifluoroethylsulfamoylamino)methyl]phenyl]prop-2-yn-1-ol |
| SMILES | O=S(=O)(NCc1ccc(C#CCO)cc1)NCC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O3S/c13-12(14,15)9-17-21(19,20)16-8-11-5-3-10(4-6-11)2-1-7-18/h3-6,16-18H,7-9H2 |
| InChIKey | ISKHLVSUEBCJKH-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|