C11H10F4N2O3S — CID 114812028
3-[2-fluoro-5-(2,2,2-trifluoroethylsulfamoylamino)phenyl]prop-2-yn-1-ol (PubChem CID 114812028) has the molecular formula C11H10F4N2O3S and a molecular weight of 326.27 g/mol. Its IUPAC name is 3-[2-fluoro-5-(2,2,2-trifluoroethylsulfamoylamino)phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-fluoro-5-(2,2,2-trifluoroethylsulfamoylamino)phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 114812028 |
| Molecular Formula | C11H10F4N2O3S |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 3-[2-fluoro-5-(2,2,2-trifluoroethylsulfamoylamino)phenyl]prop-2-yn-1-ol |
| SMILES | O=S(=O)(NCC(F)(F)F)Nc1ccc(F)c(C#CCO)c1 |
| InChI | InChI=1S/C11H10F4N2O3S/c12-10-4-3-9(6-8(10)2-1-5-18)17-21(19,20)16-7-11(13,14)15/h3-4,6,16-18H,5,7H2 |
| InChIKey | BXNINCLZASRLAA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|