C9H10F3IN2O2S — CID 114257227
3-iodo-2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)aniline (PubChem CID 114257227) has the molecular formula C9H10F3IN2O2S and a molecular weight of 394.16 g/mol. Its IUPAC name is 3-iodo-2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)aniline.
| Compound Name | 3-iodo-2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)aniline |
|---|---|
| PubChem CID | 114257227 |
| Molecular Formula | C9H10F3IN2O2S |
| Molecular Weight | 394.16 g/mol |
| Exact Mass | 393.95 |
| IUPAC Name | 3-iodo-2-methyl-N-(2,2,2-trifluoroethylsulfamoyl)aniline |
| SMILES | Cc1c(I)cccc1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H10F3IN2O2S/c1-6-7(13)3-2-4-8(6)15-18(16,17)14-5-9(10,11)12/h2-4,14-15H,5H2,1H3 |
| InChIKey | VVJUIABLNGSVPS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|