C9H8F4N2O4S — CID 114805323
4-fluoro-2-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid (PubChem CID 114805323) has the molecular formula C9H8F4N2O4S and a molecular weight of 316.23 g/mol. Its IUPAC name is 4-fluoro-2-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid.
| Compound Name | 4-fluoro-2-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid |
|---|---|
| PubChem CID | 114805323 |
| Molecular Formula | C9H8F4N2O4S |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 4-fluoro-2-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(F)cc1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H8F4N2O4S/c10-5-1-2-6(8(16)17)7(3-5)15-20(18,19)14-4-9(11,12)13/h1-3,14-15H,4H2,(H,16,17) |
| InChIKey | YIFHDNQZXGUNCO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |