C10H11F3N2O3S — CID 114808702
1-[3-(2,2,2-trifluoroethylsulfamoylamino)phenyl]ethanone (PubChem CID 114808702) has the molecular formula C10H11F3N2O3S and a molecular weight of 296.27 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethylsulfamoylamino)phenyl]ethanone.
| Compound Name | 1-[3-(2,2,2-trifluoroethylsulfamoylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 114808702 |
| Molecular Formula | C10H11F3N2O3S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethylsulfamoylamino)phenyl]ethanone |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2O3S/c1-7(16)8-3-2-4-9(5-8)15-19(17,18)14-6-10(11,12)13/h2-5,14-15H,6H2,1H3 |
| InChIKey | FSNKSUHFULZFEX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |