C6H6ClF3N4O2S — CID 114813679
2-chloro-N-(2,2,2-trifluoroethylsulfamoyl)pyrimidin-4-amine (PubChem CID 114813679) has the molecular formula C6H6ClF3N4O2S and a molecular weight of 290.65 g/mol. Its IUPAC name is 2-chloro-N-(2,2,2-trifluoroethylsulfamoyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(2,2,2-trifluoroethylsulfamoyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114813679 |
| Molecular Formula | C6H6ClF3N4O2S |
| Molecular Weight | 290.65 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 2-chloro-N-(2,2,2-trifluoroethylsulfamoyl)pyrimidin-4-amine |
| SMILES | O=S(=O)(NCC(F)(F)F)Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C6H6ClF3N4O2S/c7-5-11-2-1-4(13-5)14-17(15,16)12-3-6(8,9)10/h1-2,12H,3H2,(H,11,13,14) |
| InChIKey | BKFXVOUPYIQXIA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.65 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |