C10H8ClFN4O2S — CID 116794707
4-amino-N-(2-chloropyrimidin-4-yl)-2-fluorobenzenesulfonamide (PubChem CID 116794707) has the molecular formula C10H8ClFN4O2S and a molecular weight of 302.72 g/mol. Its IUPAC name is 4-amino-N-(2-chloropyrimidin-4-yl)-2-fluorobenzenesulfonamide.
| Compound Name | 4-amino-N-(2-chloropyrimidin-4-yl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 116794707 |
| Molecular Formula | C10H8ClFN4O2S |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 4-amino-N-(2-chloropyrimidin-4-yl)-2-fluorobenzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccnc(Cl)n2)c(F)c1 |
| InChI | InChI=1S/C10H8ClFN4O2S/c11-10-14-4-3-9(15-10)16-19(17,18)8-2-1-6(13)5-7(8)12/h1-5H,13H2,(H,14,15,16) |
| InChIKey | MRACKFJUIZCOLU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|