C11H9ClFN3O2S — CID 116798756
N-(2-chloropyrimidin-4-yl)-1-(4-fluorophenyl)methanesulfonamide (PubChem CID 116798756) has the molecular formula C11H9ClFN3O2S and a molecular weight of 301.73 g/mol. Its IUPAC name is N-(2-chloropyrimidin-4-yl)-1-(4-fluorophenyl)methanesulfonamide.
| Compound Name | N-(2-chloropyrimidin-4-yl)-1-(4-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 116798756 |
| Molecular Formula | C11H9ClFN3O2S |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | N-(2-chloropyrimidin-4-yl)-1-(4-fluorophenyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C11H9ClFN3O2S/c12-11-14-6-5-10(15-11)16-19(17,18)7-8-1-3-9(13)4-2-8/h1-6H,7H2,(H,14,15,16) |
| InChIKey | XWJQSUJJDCKUQH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |