C12H10ClFN2O2S — CID 103944038
N-(2-chloro-4-pyridinyl)-1-(4-fluorophenyl)methanesulfonamide (PubChem CID 103944038) has the molecular formula C12H10ClFN2O2S and a molecular weight of 300.74 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-1-(4-fluorophenyl)methanesulfonamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-1-(4-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 103944038 |
| Molecular Formula | C12H10ClFN2O2S |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-1-(4-fluorophenyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C12H10ClFN2O2S/c13-12-7-11(5-6-15-12)16-19(17,18)8-9-1-3-10(14)4-2-9/h1-7H,8H2,(H,15,16) |
| InChIKey | NIHOXGFBGJGRDO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|