C16H14FN3O2S — CID 84512961
1-(4-fluorophenyl)-N-[4-(1H-imidazol-5-yl)phenyl]methanesulfonamide (PubChem CID 84512961) has the molecular formula C16H14FN3O2S and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[4-(1H-imidazol-5-yl)phenyl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[4-(1H-imidazol-5-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 84512961 |
| Molecular Formula | C16H14FN3O2S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[4-(1H-imidazol-5-yl)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)Nc1ccc(-c2cnc[nH]2)cc1 |
| InChI | InChI=1S/C16H14FN3O2S/c17-14-5-1-12(2-6-14)10-23(21,22)20-15-7-3-13(4-8-15)16-9-18-11-19-16/h1-9,11,20H,10H2,(H,18,19) |
| InChIKey | QHEQMEJQQZQDGC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |