C11H10FN3O2S — CID 86804588
1-(4-fluorophenyl)-N-pyrazin-2-ylmethanesulfonamide (PubChem CID 86804588) has the molecular formula C11H10FN3O2S and a molecular weight of 267.29 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-pyrazin-2-ylmethanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-pyrazin-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 86804588 |
| Molecular Formula | C11H10FN3O2S |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 1-(4-fluorophenyl)-N-pyrazin-2-ylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)Nc1cnccn1 |
| InChI | InChI=1S/C11H10FN3O2S/c12-10-3-1-9(2-4-10)8-18(16,17)15-11-7-13-5-6-14-11/h1-7H,8H2,(H,14,15) |
| InChIKey | JZDATTNOCCSPPS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |