C15H16FNO2S — CID 30400180
N-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)methanesulfonamide (PubChem CID 30400180) has the molecular formula C15H16FNO2S and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)methanesulfonamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 30400180 |
| Molecular Formula | C15H16FNO2S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)methanesulfonamide |
| SMILES | Cc1ccc(CS(=O)(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H16FNO2S/c1-12-2-4-14(5-3-12)11-20(18,19)17-10-13-6-8-15(16)9-7-13/h2-9,17H,10-11H2,1H3 |
| InChIKey | QHCILGYNOYYBOG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |