C19H23FN2O4S2 — CID 55530270
1-(4-fluorophenyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]methanesulfonamide (PubChem CID 55530270) has the molecular formula C19H23FN2O4S2 and a molecular weight of 426.54 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 55530270 |
| Molecular Formula | C19H23FN2O4S2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)NCc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H23FN2O4S2/c20-18-8-4-17(5-9-18)15-27(23,24)21-14-16-6-10-19(11-7-16)28(25,26)22-12-2-1-3-13-22/h4-11,21H,1-3,12-15H2 |
| InChIKey | ZJQSXQYICHJFOI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |