C8H10ClN3O4S — CID 116798767
ethyl 2-[(2-chloropyrimidin-4-yl)sulfamoyl]acetate (PubChem CID 116798767) has the molecular formula C8H10ClN3O4S and a molecular weight of 279.70 g/mol. Its IUPAC name is ethyl 2-[(2-chloropyrimidin-4-yl)sulfamoyl]acetate.
| Compound Name | ethyl 2-[(2-chloropyrimidin-4-yl)sulfamoyl]acetate |
|---|---|
| PubChem CID | 116798767 |
| Molecular Formula | C8H10ClN3O4S |
| Molecular Weight | 279.70 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | ethyl 2-[(2-chloropyrimidin-4-yl)sulfamoyl]acetate |
| SMILES | CCOC(=O)CS(=O)(=O)Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C8H10ClN3O4S/c1-2-16-7(13)5-17(14,15)12-6-3-4-10-8(9)11-6/h3-4H,2,5H2,1H3,(H,10,11,12) |
| InChIKey | NIRBVHFIZHAJPM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.70 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |